2933-29-1 Usage
Uses
Used in Pharmaceutical Industry:
4,5,6,7-tetrahydro-2-amino-benzothiazol is used as a key intermediate in the development of drugs for treating neurological disorders and cancer. Its presence in the molecular structure of these drugs aids in modulating their therapeutic effects and improving their efficacy.
Used in Dye and Pigment Industry:
4,5,6,7-tetrahydro-2-amino-benzothiazol is used as a building block in the synthesis of various dyes and pigments. Its unique chemical properties contribute to the color intensity and stability of these dyes and pigments, making them suitable for various applications, such as textiles, plastics, and printing inks.
Used in Agrochemical Industry:
In the agrochemical industry, 4,5,6,7-tetrahydro-2-amino-benzothiazol is used in the production of pesticides and other agricultural chemicals. Its incorporation into these chemicals enhances their effectiveness in pest control, thereby contributing to improved crop yields and protection against various pests and diseases.
Overall, 4,5,6,7-tetrahydro-2-amino-benzothiazol is an important chemical compound with diverse applications across various industries, including medicine, dyes and pigments, and agrochemicals. Its unique structure and functional groups make it a valuable building block in the synthesis of a wide range of organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 2933-29-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,3 and 3 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 2933-29:
(6*2)+(5*9)+(4*3)+(3*3)+(2*2)+(1*9)=91
91 % 10 = 1
So 2933-29-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2S/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H2,(H2,8,9)
