29366-81-2 Usage
Uses
Used in Materials Science:
2,4-Diamino-6-(2-azidophenyl)-1,3,5-triazine is used as a precursor in the synthesis of new compounds and materials. Its azide functional group makes it a useful building block for the preparation of various organic compounds, polymers, and materials with desired properties.
Used in Organic Synthesis:
2,4-Diamino-6-(2-azidophenyl)-1,3,5-triazine is used as a key intermediate in the synthesis of complex organic molecules. Its presence of both amino and azide groups allows for versatile chemical reactions and the formation of a wide range of products.
Used in Photoinitiation:
2,4-Diamino-6-(2-azidophenyl)-1,3,5-triazine is used as a photoinitiator in the synthesis of polymers and materials using photolithography techniques. Its azide group can be activated by light, initiating polymerization reactions and enabling the creation of patterned structures in materials.
Used in Pharmaceutical Industry:
2,4-Diamino-6-(2-azidophenyl)-1,3,5-triazine is used as a potential candidate for the development of new drugs. Its unique structure and functional groups can be exploited to design molecules with specific biological activities, such as antimicrobial, antiviral, or anticancer properties.
Used in Chemical Research:
2,4-Diamino-6-(2-azidophenyl)-1,3,5-triazine is used as a model compound in fundamental research to study the reactivity and properties of triazine derivatives and their potential applications in various fields. This helps in understanding the underlying chemistry and exploring new synthetic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 29366-81-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,3,6 and 6 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 29366-81:
(7*2)+(6*9)+(5*3)+(4*6)+(3*6)+(2*8)+(1*1)=142
142 % 10 = 2
So 29366-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N8/c10-8-13-7(14-9(11)15-8)5-3-1-2-4-6(5)16-17-12/h1-4,12H,(H4,10,11,13,14,15)/q+1
