2942-05-4 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
Benzothiazole, 7-nitro(6CI,7CI,8CI,9CI) serves as a crucial building block in the synthesis of pharmaceuticals and agrochemicals. Its unique structure allows it to be a key component in the development of new drugs and agricultural chemicals, enhancing their efficacy and targeting specific biological pathways.
Used in Organic Synthesis:
Benzothiazole, 7-nitro(6CI,7CI,8CI,9CI) is utilized in organic synthesis for the creation of various organic compounds. Its versatility in chemical reactions makes it a valuable intermediate for the production of a wide range of chemical products.
Used in Dye Production:
Benzothiazole, 7-nitro(6CI,7CI,8CI,9CI) is also employed in the production of dyes. Its chemical properties contribute to the color and stability of the dyes, making it an important component in the dye manufacturing process.
Used in Antimicrobial and Antifungal Applications:
Due to its potential biological and pharmacological activities, Benzothiazole, 7-nitro(6CI,7CI,8CI,9CI) has been studied for its antimicrobial and antifungal properties. It may be used in applications where resistance to common antimicrobial agents is a concern, offering an alternative or adjunct treatment option.
Used in Research and Development:
As a nitro derivative, Benzothiazole, 7-nitro(6CI,7CI,8CI,9CI) holds promise for research and development in diverse scientific fields. Its unique characteristics make it a subject of interest for further exploration and potential innovation in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2942-05-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,4 and 2 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2942-05:
(6*2)+(5*9)+(4*4)+(3*2)+(2*0)+(1*5)=84
84 % 10 = 4
So 2942-05-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N2O2S/c10-9(11)6-3-1-2-5-7(6)12-4-8-5/h1-4H
