29427-49-4 Usage
Uses
Used in Pharmaceutical Industry:
5'-Fluoro-2'-methylacetophenone is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and reactivity contribute to the development of new drugs with improved therapeutic properties and efficacy.
Used in Agrochemical Industry:
In the agrochemical sector, 5'-Fluoro-2'-methylacetophenone serves as an essential intermediate for the production of agrochemicals. Its incorporation into these compounds enhances their effectiveness in pest control and crop protection.
Used in Food Industry:
5'-Fluoro-2'-methylacetophenone is utilized as a flavoring agent in the food industry. Its distinct properties allow it to impart unique flavors and aromas to various food products, enhancing their overall taste and appeal.
Used in Organic Chemistry Research:
5'-Fluoro-2'-methylacetophenone is also employed in organic chemistry research for studying the effects of fluorination and methylation on the reactivity and properties of acetophenone derivatives. This research contributes to the development of new synthetic methods and the discovery of novel compounds with potential applications in various fields.
Used in Industrial Processes:
5'-Fluoro-2'-methylacetophenone's versatility extends to its use in various industrial processes, where it may be employed as a catalyst, solvent, or reactant in the production of a wide range of chemical products. Its unique properties enable it to improve the efficiency and selectivity of these processes, leading to the development of more sustainable and cost-effective methods.
Check Digit Verification of cas no
The CAS Registry Mumber 29427-49-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,4,2 and 7 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 29427-49:
(7*2)+(6*9)+(5*4)+(4*2)+(3*7)+(2*4)+(1*9)=134
134 % 10 = 4
So 29427-49-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H9FO/c1-6-3-4-8(10)5-9(6)7(2)11/h3-5H,1-2H3
