294648-38-7 Usage
Uses
Used in Pharmaceutical Industry:
(6-PHENYL-3-PYRIDINYL)METHYLAMINE is used as an intermediate in the synthesis of various drugs and pharmaceuticals, contributing to the development of new medications for different health conditions.
Used in Chemical Synthesis:
(6-PHENYL-3-PYRIDINYL)METHYLAMINE is used as a building block in the synthesis of other organic compounds, playing a crucial role in creating complex molecules for various applications.
Used as a Reagent:
In chemical reactions, (6-PHENYL-3-PYRIDINYL)METHYLAMINE is sometimes employed as a reagent, facilitating specific transformations or processes in the synthesis of target compounds.
Used in Disease and Condition Treatment:
Due to its biological activity, (6-PHENYL-3-PYRIDINYL)METHYLAMINE has been studied for its potential applications in the treatment of various diseases and conditions, offering a promising avenue for therapeutic development.
Check Digit Verification of cas no
The CAS Registry Mumber 294648-38-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,4,6,4 and 8 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 294648-38:
(8*2)+(7*9)+(6*4)+(5*6)+(4*4)+(3*8)+(2*3)+(1*8)=187
187 % 10 = 7
So 294648-38-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2/c13-8-10-6-7-12(14-9-10)11-4-2-1-3-5-11/h1-7,9H,8,13H2
