294656-36-3 Usage
Uses
Used in Pharmaceutical Synthesis:
1H-Benzimidazole-2-methanol,5-amino-(9CI) is used as a key intermediate in the synthesis of pharmaceuticals for its versatile chemical structure and potential biological activities. Its presence in the molecular structure allows for the development of new drugs with improved therapeutic effects.
Used in Agrochemical Synthesis:
In the agrochemical industry, 1H-Benzimidazole-2-methanol,5-amino-(9CI) is used as a building block for the creation of new agrochemicals. Its unique structure contributes to the development of effective compounds for pest control and crop protection.
Used in Organic Synthesis:
1H-Benzimidazole-2-methanol,5-amino-(9CI) serves as a versatile starting material in organic synthesis, enabling the production of various organic compounds with different functional groups and properties. Its reactivity and structural features make it suitable for a wide range of chemical reactions and applications.
Used in Biological Research:
1H-Benzimidazole-2-methanol,5-amino-(9CI) is studied for its potential antimicrobial and antitumor properties, making it a valuable compound in biological research. Its unique structure and functional groups allow for the exploration of new therapeutic agents and the understanding of their mechanisms of action.
Overall, 1H-Benzimidazole-2-methanol,5-amino-(9CI) is a multifaceted chemical compound with diverse applications across various industries, including pharmaceuticals, agrochemicals, organic synthesis, and biological research. Its unique structure and properties make it a promising candidate for the development of new compounds and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 294656-36-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,4,6,5 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 294656-36:
(8*2)+(7*9)+(6*4)+(5*6)+(4*5)+(3*6)+(2*3)+(1*6)=183
183 % 10 = 3
So 294656-36-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3O/c9-5-1-2-6-7(3-5)11-8(4-12)10-6/h1-3,12H,4,9H2,(H,10,11)
