29471-77-0 Usage
Uses
Used in Adhesives and Coatings Industry:
POLY(2-VINYL-1-METHYLPYRIDINIUM BROMIDE) is used as a component in adhesives and coatings for its ability to enhance the adhesion and stability of these products. Its cationic nature allows for strong interactions with various surfaces, improving the overall performance of the final product.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, POLY(2-VINYL-1-METHYLPYRIDINIUM BROMIDE) is utilized as an excipient or active ingredient in drug formulations. Its cationic properties enable it to interact with biological molecules, making it suitable for applications such as drug delivery systems and targeted therapies.
Used in Water Treatment Industry:
POLY(2-VINYL-1-METHYLPYRIDINIUM BROMIDE) is used as a flocculant in water treatment processes. Its cationic charge allows it to effectively bind with negatively charged particles in water, facilitating their aggregation and removal, thus improving water quality.
Used in Emulsion Polymerization:
In the field of emulsion polymerization, POLY(2-VINYL-1-METHYLPYRIDINIUM BROMIDE) serves as a stabilizer. Its cationic nature helps to prevent the coalescence of polymer particles, ensuring a stable and uniform emulsion, which is crucial for the production of high-quality polymer products.
Overall, the versatility and stability of POLY(2-VINYL-1-METHYLPYRIDINIUM BROMIDE) make it a valuable compound in numerous fields and industries, including adhesives and coatings, pharmaceuticals, water treatment, and emulsion polymerization.
Check Digit Verification of cas no
The CAS Registry Mumber 29471-77-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,4,7 and 1 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 29471-77:
(7*2)+(6*9)+(5*4)+(4*7)+(3*1)+(2*7)+(1*7)=140
140 % 10 = 0
So 29471-77-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N.BrH/c1-3-8-6-4-5-7-9(8)2;/h3-7H,1H2,2H3;1H/q+1;/p-1
