29508-48-3 Usage
General Description
1,5-dimethyl-3-[(2-methyl-1H-indol-3-yl)azo]-2-phenyl-1H-pyrazolium methyl sulphate is a chemical compound with a complex molecular structure. It contains a pyrazolium and an azo group, along with methyl and phenyl groups. The presence of sulfur in the form of methyl sulfate adds to its chemical complexity. 1,5-dimethyl-3-[(2-methyl-1H-indol-3-yl)azo]-2-phenyl-1H-pyrazolium methyl sulphate is often used in organic chemistry research and as a reagent in various chemical reactions. Its unique structure and properties make it valuable in the study of molecular interactions and the development of new synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 29508-48-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,5,0 and 8 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 29508-48:
(7*2)+(6*9)+(5*5)+(4*0)+(3*8)+(2*4)+(1*8)=133
133 % 10 = 3
So 29508-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C20H21N5.CH4O4S/c1-14-13-19(25(24(14)3)16-9-5-4-6-10-16)22-23-20-15(2)21-18-12-8-7-11-17(18)20;1-5-6(2,3)4/h4-14,22H,1-3H3;1H3,(H,2,3,4)/b23-20-;