29512-46-7 Usage
General Description
The chemical compound 6'-(diethylamino)-2'-(phenylamino)spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one, also known as Diethylaminorhodamine 123, is a fluorescent dye used in biological research and medical diagnostics. It is often used to stain and visualize mitochondria and other cellular structures in live cells. The compound has a spiro structure, which allows it to exhibit fluorescence in a wide range of wavelengths, making it useful for various imaging applications. Diethylaminorhodamine 123 is also known for its high photostability and low cytotoxicity, making it a valuable tool for studying cellular processes and functions. Additionally, it has been used in the development of fluorescent sensors for detecting biological analytes and monitoring cellular activities.
Check Digit Verification of cas no
The CAS Registry Mumber 29512-46-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,5,1 and 2 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 29512-46:
(7*2)+(6*9)+(5*5)+(4*1)+(3*2)+(2*4)+(1*6)=117
117 % 10 = 7
So 29512-46-7 is a valid CAS Registry Number.
InChI:InChI=1/C30H26N2O3/c1-3-32(4-2)22-15-16-25-28(19-22)34-27-17-14-21(31-20-10-6-5-7-11-20)18-26(27)30(25)24-13-9-8-12-23(24)29(33)35-30/h5-19,31H,3-4H2,1-2H3