29550-94-5 Usage
Derivative of benzoic acid
2-[(2-methyl-3-furoyl)amino]benzoic acid is derived from benzoic acid, which is a simple carboxylic acid with the molecular formula C7H6O2.
Furoylamine moiety
The compound contains a furoylamine group, which is a five-membered heterocyclic ring with a side chain containing an amine group (-NH2).
Research reagent
2-[(2-methyl-3-furoyl)amino]benzoic acid is often used as a research reagent in the study of various biological processes, such as enzyme activity and protein interactions.
Building block in organic synthesis
The compound serves as a starting material or intermediate in the synthesis of more complex organic molecules.
Anti-inflammatory properties
2-[(2-methyl-3-furoyl)amino]benzoic acid has been shown to exhibit anti-inflammatory properties, which can help reduce swelling, redness, and pain in the body.
Analgesic properties
The compound also has analgesic (pain-relieving) properties, making it a potential candidate for the development of new pharmaceutical drugs to treat pain.
Production of dyes and pigments
2-[(2-methyl-3-furoyl)amino]benzoic acid is utilized in the production of various chemical products, such as dyes and pigments, due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 29550-94-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,5,5 and 0 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 29550-94:
(7*2)+(6*9)+(5*5)+(4*5)+(3*0)+(2*9)+(1*4)=135
135 % 10 = 5
So 29550-94-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H11NO4/c1-8-9(6-7-18-8)12(15)14-11-5-3-2-4-10(11)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)
