29554-26-5 Usage
Uses
Used in Pharmaceutical Industry:
N-(4-Aminobutyl)-3-(3,4-dihydroxyphenyl)propenamide is used as a pharmaceutical compound for its potential therapeutic effects. N-(4-Aminobutyl)-3-(3,4-dihydroxyphenyl)propenamide's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Research Applications:
In the field of scientific research, N-(4-Aminobutyl)-3-(3,4-dihydroxyphenyl)propenamide is used as a research tool to study the interactions between molecules and biological systems. Its unique structure can provide insights into the mechanisms of various biological processes and help in the development of targeted therapies.
Used in Chemical Synthesis:
N-(4-Aminobutyl)-3-(3,4-dihydroxyphenyl)propenamide can also be used as a starting material or intermediate in the synthesis of other complex organic compounds. Its versatile structure makes it a valuable building block for the creation of novel molecules with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 29554-26-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,5,5 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 29554-26:
(7*2)+(6*9)+(5*5)+(4*5)+(3*4)+(2*2)+(1*6)=135
135 % 10 = 5
So 29554-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H18N2O3/c14-7-1-2-8-15-13(18)6-4-10-3-5-11(16)12(17)9-10/h3-6,9,16-17H,1-2,7-8,14H2,(H,15,18)/b6-4+
