295790-49-7 Usage
Uses
Used in Pharmaceutical Industry:
5-Fluoro-2-piperidin-4-yl-1H-benzoimidazole is used as a pharmaceutical agent for its potential therapeutic applications. The presence of the benzimidazole group, which is known for its association with various biological activities, makes it a promising candidate for the development of new drugs. The piperidine ring further enhances its pharmacological properties, making it a valuable compound for medicinal chemistry research and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 295790-49-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,5,7,9 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 295790-49:
(8*2)+(7*9)+(6*5)+(5*7)+(4*9)+(3*0)+(2*4)+(1*9)=197
197 % 10 = 7
So 295790-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H14FN3/c13-9-1-2-10-11(7-9)16-12(15-10)8-3-5-14-6-4-8/h1-2,7-8,14H,3-6H2,(H,15,16)