29595-61-7 Usage
Uses
Used in Pesticide Production:
Trichloronitrobenzene is used as an intermediate in the production of pesticides, such as chlorpyrifos, for its effectiveness in controlling various pests and protecting crops.
Used in Dye Synthesis:
It serves as a precursor in the synthesis of dyes, contributing to the development of colorants used in various industries.
Used in Pharmaceutical Synthesis:
Trichloronitrobenzene is also utilized as a precursor in the synthesis of pharmaceuticals, playing a crucial role in the creation of certain medications.
However, due to its hazardous nature, it is imperative to handle, store, and dispose of trichloronitrobenzene with extreme care to prevent adverse effects on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 29595-61-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,5,9 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 29595-61:
(7*2)+(6*9)+(5*5)+(4*9)+(3*5)+(2*6)+(1*1)=157
157 % 10 = 7
So 29595-61-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H
