29605-99-0 Usage
Uses
Used in Pharmaceutical Industry:
2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazol-4-yl]acetic acid is used as a pharmaceutical compound for its potential biological activity. The presence of hydroxyl groups allows for hydrogen bonding and interactions with biological molecules, which may contribute to its therapeutic effects.
Used in Biochemical Research:
In the field of biochemistry, 2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazol-4-yl]acetic acid serves as a valuable research tool. Its complex structure and potential for biological interactions make it suitable for studying molecular recognition, enzyme inhibition, and other biochemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 29605-99-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,6,0 and 5 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 29605-99:
(7*2)+(6*9)+(5*6)+(4*0)+(3*5)+(2*9)+(1*9)=140
140 % 10 = 0
So 29605-99-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O6/c13-3-6-8(16)9(17)10(18-6)12-2-5(11-4-12)1-7(14)15/h2,4,6,8-10,13,16-17H,1,3H2,(H,14,15)/t6-,8-,9-,10-/m1/s1
