2961-87-7 Usage
Uses
Used in Pharmaceutical Development:
2,4,6-Cycloheptatrien-1-one, 2-hydroxy-3-iodo-, p-nitrobenzoate is used as a key intermediate in the synthesis of pharmaceutical compounds. Its unique structure and functional groups can be utilized to create novel drug molecules with potential therapeutic applications.
Used in Material Science:
In the field of material science, 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-3-iodo-, p-nitrobenzoate can be used as a building block for the development of new materials with specific properties. Its reactivity and the presence of various functional groups allow for the creation of polymers, coatings, or other materials with tailored characteristics.
Used in Catalysis:
2,4,6-Cycloheptatrien-1-one, 2-hydroxy-3-iodo-, p-nitrobenzoate can be employed as a catalyst or a catalyst precursor in various chemical reactions. Its reactive functional groups can facilitate or enhance the reaction rates, making it a valuable component in catalytic processes.
Used in Organic Synthesis:
As a highly reactive compound, 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-3-iodo-, p-nitrobenzoate is used as a versatile building block in organic synthesis. Its unique structure and functional groups enable the formation of a wide range of organic compounds, making it a valuable asset in the synthesis of complex molecules and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 2961-87-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,6 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2961-87:
(6*2)+(5*9)+(4*6)+(3*1)+(2*8)+(1*7)=107
107 % 10 = 7
So 2961-87-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H8INO5/c15-11-3-1-2-4-12(17)13(11)21-14(18)9-5-7-10(8-6-9)16(19)20/h1-8H
