29639-68-7 Usage
General Description
4,6-Dihydroxy-2-methythiopyrimidine is a chemical compound with the molecular formula C6H6N2O2S. It is a pyrimidine derivative and contains two hydroxyl groups and a methylthio group. 4,6-Dihydroxy-2-methythiopyrimidine is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its structural significance and versatile reactivity. It is also known for its potential biological activities, with research indicating its potential use as an anti-bacterial and anti-fungal agent. Additionally, 4,6-Dihydroxy-2-methythiopyrimidine has been studied for its potential antioxidant and neuroprotective properties, making it a molecule of interest in various fields of research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 29639-68-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,6,3 and 9 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 29639-68:
(7*2)+(6*9)+(5*6)+(4*3)+(3*9)+(2*6)+(1*8)=157
157 % 10 = 7
So 29639-68-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O2S/c1-10-5-6-3(8)2-4(9)7-5/h2H2,1H3,(H,6,7,8,9)
29639-68-7Relevant articles and documents
Reaction of Thiobarbituric Acid and Hydrazine: Formation of a Secondary Amine
Pradhan, P. C.,Mishra, B. K.,Behera, G. B.
, p. 1097 - 1098 (2007/10/02)
Reaction of 2-methylmercaptobarbituric acid (2) with hydrazine leads to a secondary amine, 2,2-bis(3,4,5,6-tetrahydropyrimidyl)amine (4) instead of s-trihydrazinopyrimidine.A plausible mechanism is proposed for the formation of 4.
