29654-08-8 Usage
Uses
Used in Organic Synthesis:
1-(2-chloro-4-iodophenyl)hydrazine is used as a building block in organic synthesis for the preparation of various other organic compounds. Its unique structure with both chlorine and iodine atoms allows for versatile chemical reactions and the formation of diverse organic products.
Used in Pharmaceutical Research:
In pharmaceutical research, 1-(2-chloro-4-iodophenyl)hydrazine is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its potential chemical and biological properties make it a valuable candidate for the development of new drugs and therapeutic agents.
Used in Chemical and Biological Studies:
Due to the presence of both chlorine and iodine atoms, 1-(2-chloro-4-iodophenyl)hydrazine may exhibit interesting chemical and biological properties. It is used in studies to explore its reactivity, stability, and potential interactions with other molecules, which can contribute to the understanding of its properties and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 29654-08-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,6,5 and 4 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 29654-08:
(7*2)+(6*9)+(5*6)+(4*5)+(3*4)+(2*0)+(1*8)=138
138 % 10 = 8
So 29654-08-8 is a valid CAS Registry Number.
InChI:InChI=1S/C6H6ClIN2/c7-5-3-4(8)1-2-6(5)10-9/h1-3,10H,9H2
