2969-61-1 Usage
Uses
Used in Pharmaceutical Industry:
2,5-difluorofluoren-9-one is used as a precursor for the synthesis of various fluorinated organic compounds, particularly in the development of new drugs. Its unique structure and properties, along with the presence of fluorine atoms, make it useful for medicinal chemistry applications, enhancing the stability and metabolic resistance of the synthesized compounds.
Used in Agrochemical Industry:
In the agrochemical industry, 2,5-difluorofluoren-9-one serves as a building block for the synthesis of various fluorinated agrochemicals. Its unique structure and properties contribute to the development of more effective and stable agrochemicals, improving their performance and reducing environmental impact.
Used in Materials Science:
2,5-difluorofluoren-9-one is used as a precursor in the synthesis of advanced materials with specific properties. Its fluorinated structure allows for the development of materials with enhanced stability, resistance to degradation, and tailored properties for various applications in materials science, such as polymers, coatings, and sensors.
Check Digit Verification of cas no
The CAS Registry Mumber 2969-61-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,6 and 9 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2969-61:
(6*2)+(5*9)+(4*6)+(3*9)+(2*6)+(1*1)=121
121 % 10 = 1
So 2969-61-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H6F2O/c14-7-4-5-8-10(6-7)13(16)9-2-1-3-11(15)12(8)9/h1-6H
