298186-32-0 Usage
Hydrazide derivative
A compound that contains a hydrazide functional group (-NHNH2) This indicates that 2-[(7-Methyl-2,3-dihydro-1H-inden-4-yl)oxy]acetohydrazide is derived from a hydrazide compound, which is known for its reactivity and is commonly used in the synthesis of various pharmaceuticals.
Acetohydrazide group
A chemical group derived from acetic acid and hydrazine The presence of this group in the compound suggests that it may have similar reactivity and properties to other compounds containing the acetohydrazide group.
7-Methyl-2,3-dihydro-1H-inden-4-yl moiety
A bulky organic group attached to the acetohydrazide This group is responsible for the compound's unique structure and may influence its reactivity and potential applications in medicinal chemistry.
Applications in medicinal chemistry
The compound may be used as a building block for the synthesis of potential pharmaceutical compounds This suggests that 2-[(7-Methyl-2,3-dihydro-1H-inden-4-yl)oxy]acetohydrazide could be a valuable intermediate in the development of new drugs or drug candidates.
Specific properties and uses may vary
The properties and applications of the compound may change depending on the context in which it is used This highlights the importance of understanding the specific requirements and conditions of each application when working with this compound.
Further research may be necessary
To fully understand the potential applications of 2-[(7-Methyl-2,3-dihydro-1H-inden-4-yl)oxy]acetohydrazide This indicates that more studies and experiments are needed to explore the compound's potential uses and to optimize its properties for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 298186-32-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,8,1,8 and 6 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 298186-32:
(8*2)+(7*9)+(6*8)+(5*1)+(4*8)+(3*6)+(2*3)+(1*2)=190
190 % 10 = 0
So 298186-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2O2/c1-8-5-6-11(16-7-12(15)14-13)10-4-2-3-9(8)10/h5-6H,2-4,7,13H2,1H3,(H,14,15)
