298187-48-1 Usage
Description
2-(CHLOROMETHYL)-5-(3-METHYL-4-NITROPHENYL)-1,3,4-OXADIAZOLE is a chemical compound belonging to the 1,3,4-oxadiazole family, characterized by a molecular formula of C10H8ClN3O3. It features a chloromethyl group and a nitrophenyl group, which contribute to its diverse properties and reactivity. 2-(CHLOROMETHYL)-5-(3-METHYL-4-NITROPHENYL)-1,3,4-OXADIAZOLE is recognized for its potential applications across various fields, including pharmaceuticals, agrochemicals, and materials science.
Uses
Used in Pharmaceutical Industry:
2-(CHLOROMETHYL)-5-(3-METHYL-4-NITROPHENYL)-1,3,4-OXADIAZOLE is used as a building block for the synthesis of new compounds, leveraging its chloromethyl and nitrophenyl groups to create molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In agrochemicals, 2-(CHLOROMETHYL)-5-(3-METHYL-4-NITROPHENYL)-1,3,4-OXADIAZOLE is utilized as a key intermediate in the development of novel agrochemical products, such as pesticides and herbicides, due to its reactive functional groups.
Used in Materials Science:
2-(CHLOROMETHYL)-5-(3-METHYL-4-NITROPHENYL)-1,3,4-OXADIAZOLE is employed as a component in the synthesis of advanced materials, taking advantage of its unique structural features to create materials with specific electronic, optical, or mechanical properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 298187-48-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,8,1,8 and 7 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 298187-48:
(8*2)+(7*9)+(6*8)+(5*1)+(4*8)+(3*7)+(2*4)+(1*8)=201
201 % 10 = 1
So 298187-48-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClN3O3/c1-6-4-7(2-3-8(6)14(15)16)10-13-12-9(5-11)17-10/h2-4H,5H2,1H3
