29875-05-6 Usage
Uses
Used in Organic Synthesis:
2-Methylbenzylmagnesium chloride is used as a Grignard reagent for various organic synthesis applications. It is particularly effective in reactions involving the addition to carbonyl compounds, leading to the formation of alcohols, carboxylic acids, or ketones.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Methylbenzylmagnesium chloride is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its reactivity and nucleophilic properties make it a valuable tool for the development of new drugs and the modification of existing ones.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, 2-Methylbenzylmagnesium chloride is utilized as a reagent in the synthesis of agrochemicals, such as pesticides and herbicides. Its ability to participate in a wide range of reactions contributes to the creation of novel and effective agrochemical products.
Used in Research and Development:
2-Methylbenzylmagnesium chloride is also used in research and development settings, where its unique properties are harnessed to explore new chemical reactions and develop innovative synthetic pathways. This contributes to the advancement of organic chemistry and the discovery of new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 29875-05-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,8,7 and 5 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 29875-05:
(7*2)+(6*9)+(5*8)+(4*7)+(3*5)+(2*0)+(1*5)=156
156 % 10 = 6
So 29875-05-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H9.ClH.Mg/c1-7-5-3-4-6-8(7)2;;/h3-6H,1H2,2H3;1H;/q-1;;+2/p-1
