29875-06-7 Usage
Uses
Used in Organic Synthesis:
3-Methylbenzylmagnesium chloride is used as a reagent for the synthesis of organic compounds, primarily facilitating the formation of carbon-carbon bonds through Grignard reactions. Its nucleophilic nature allows it to participate in a wide range of organic transformations, making it a valuable tool in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Methylbenzylmagnesium chloride is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its ability to form carbon-carbon bonds is particularly useful in the development of novel drug molecules with specific therapeutic properties.
Used in Chemical Research:
3-Methylbenzylmagnesium chloride is also employed in chemical research as a versatile reagent for exploring new reaction pathways and mechanisms. Its reactivity and nucleophilic character make it an ideal candidate for studying the behavior of Grignard reagents in different chemical contexts.
It is crucial to handle 3-Methylbenzylmagnesium chloride with caution due to its high reactivity, as it can react violently with water or air, necessitating proper safety measures during its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 29875-06-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,8,7 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 29875-06:
(7*2)+(6*9)+(5*8)+(4*7)+(3*5)+(2*0)+(1*6)=157
157 % 10 = 7
So 29875-06-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H9.ClH.Mg/c1-7-4-3-5-8(2)6-7;;/h3-6H,1H2,2H3;1H;/q;;+1/p-1/rC8H9ClMg/c1-7-3-2-4-8(5-7)6-10-9/h2-5H,6H2,1H3
