299166-55-5 Usage
Uses
Used in Scientific Research:
AKOS BBS-00004526 is used as a chemical compound for conducting various scientific experiments and research. Its complex structure makes it a valuable resource for chemists and researchers in the field.
Used in Chemical Experiments:
AKOS BBS-00004526 is used as a reagent in chemical experiments, allowing chemists to explore its properties and potential applications in different areas of study.
Note: Since the exact properties, uses, and safety measures for AKOS BBS-00004526 are not readily available, it is essential for users to consult specialized chemical knowledge or conduct further research to ensure safe and effective utilization of AKOS BBS-00004526.
Check Digit Verification of cas no
The CAS Registry Mumber 299166-55-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,9,1,6 and 6 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 299166-55:
(8*2)+(7*9)+(6*9)+(5*1)+(4*6)+(3*6)+(2*5)+(1*5)=195
195 % 10 = 5
So 299166-55-5 is a valid CAS Registry Number.
InChI:InChI=1S/C7H10N4O/c8-9-7(12)6-4-2-1-3-5(4)10-11-6/h1-3,8H2,(H,9,12)(H,10,11)
