2997-63-9 Usage
General Description
ETHYL 4,6-DIOXO-5-PHENYL-1,3A,4,5,6,6A-HEXAHYDROPYRROLO[3,4-C]PYRAZOLE-3-CARBOXYLATE is a chemical compound with a complex molecular structure. It is categorized as a carboxylate ester and contains a hexahydropyrrolopyrazole ring system with a phenyl group attached. ETHYL 4,6-DIOXO-5-PHENYL-1,3A,4,5,6,6A-HEXAHYDROPYRROLO[3,4-C]PYRAZOLE-3-CARBOXYLATE has potential applications in medicinal chemistry and drug development due to its unique structure and potential biological activities. Further research and studies are needed to understand its properties and potential uses in various fields, including pharmaceuticals and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 2997-63-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,9 and 7 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2997-63:
(6*2)+(5*9)+(4*9)+(3*7)+(2*6)+(1*3)=129
129 % 10 = 9
So 2997-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H13N3O4/c1-2-21-14(20)11-9-10(15-16-11)13(19)17(12(9)18)8-6-4-3-5-7-8/h3-7,9-10,15H,2H2,1H3/t9-,10-/m1/s1
2997-63-9Relevant articles and documents
Reactions of aliphatic diazo compounds: I. Reaction of diazoacetic acid esters with maleimides
Molchanov,Stepakov,Kostikov
, p. 1139 - 1143 (2007/10/03)
Diazoacetic acid esters regioselectively add to 2-R-substituted maleimides to afford 2-pyrazoline derivatives, 1-R-6,8-dioxo-2,3,7-triazabicyclo[3.3.0]oct-3-ene-4-carboxylic acid esters.