299920-95-9 Usage
Uses
Used in Pharmaceutical Industry:
5-METHYL-4-PIPERIDIN-1-YLMETHYL-FURAN-2-CARBOXYLIC ACID serves as a crucial building block for the synthesis of various medications. Its unique structure allows it to be a versatile component in the creation of new pharmaceuticals, contributing to the development of innovative treatments for a range of diseases.
Used in Drug Discovery and Development:
In the realm of drug discovery and development, 5-METHYL-4-PIPERIDIN-1-YLMETHYL-FURAN-2-CARBOXYLIC ACID is employed as an intermediate for the synthesis of biologically active compounds. Its potential medicinal properties make it a valuable asset in the search for new therapeutic agents, particularly for the treatment of various diseases where existing treatments may be limited or ineffective.
Check Digit Verification of cas no
The CAS Registry Mumber 299920-95-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,9,9,2 and 0 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 299920-95:
(8*2)+(7*9)+(6*9)+(5*9)+(4*2)+(3*0)+(2*9)+(1*5)=209
209 % 10 = 9
So 299920-95-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO3/c1-9-10(7-11(16-9)12(14)15)8-13-5-3-2-4-6-13/h7H,2-6,8H2,1H3,(H,14,15)
