30077-58-8 Usage
Uses
Used in Pharmaceutical Industry:
2,4-Diamino-5-(3,4-dichlorobenzyl)pyrimidine is used as an intermediate in the synthesis of pharmaceuticals for its potential role in the development of antiviral and anticancer drugs. Its structural features make it a promising candidate for creating new therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4-Diamino-5-(3,4-dichlorobenzyl)pyrimidine is also utilized as an intermediate in the synthesis of various agrochemicals, contributing to the development of new compounds for agricultural applications.
Used in Research and Development:
2,4-Diamino-5-(3,4-dichlorobenzyl)pyrimidine serves as a key component in the research and development of new chemical compounds across different industries. Its unique structure allows scientists to explore its properties and potential uses in creating innovative materials and substances.
Check Digit Verification of cas no
The CAS Registry Mumber 30077-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,0,7 and 7 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 30077-58:
(7*3)+(6*0)+(5*0)+(4*7)+(3*7)+(2*5)+(1*8)=88
88 % 10 = 8
So 30077-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10Cl2N4/c12-8-2-1-6(4-9(8)13)3-7-5-16-11(15)17-10(7)14/h1-2,4-5H,3H2,(H4,14,15,16,17)
