30266-58-1 Usage
Uses
Used in Pharmaceutical Industry:
1,2,3,4-TETRAOXO-1,2,3,4-TETRAHYDRONAPHTHALENE DIHYDRATE is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure allows it to serve as a key building block in the development of new medications with potential therapeutic benefits.
Used in Chemical Research:
In the field of chemical research, 1,2,3,4-TETRAOXO-1,2,3,4-TETRAHYDRONAPHTHALENE DIHYDRATE is utilized as a research compound to study its properties and potential reactions with other chemicals. This can lead to the discovery of new chemical compounds and applications.
Used in Material Science:
1,2,3,4-TETRAOXO-1,2,3,4-TETRAHYDRONAPHTHALENE DIHYDRATE may also find applications in material science, where its unique structure can be employed to develop new materials with specific properties, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 30266-58-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,2,6 and 6 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 30266-58:
(7*3)+(6*0)+(5*2)+(4*6)+(3*6)+(2*5)+(1*8)=91
91 % 10 = 1
So 30266-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H4O4/c11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h1-4H
30266-58-1Relevant academic research and scientific papers
Superoxide Oxidation: A Novel Route to Aromatic 1,2-Dicarboxylic Acids
Sotiriou, Chariklia,Lee, Wenni,Giese, Roger W.
, p. 2159 - 2164 (2007/10/02)
Potassium superoxide in aprotic media, in the presence of 18-crown-6 ether, effects a novel and mild oxidative cleavage of quinones, cyclic alcohols, and ketones fused to various aromatic hydrocarbons.Aromatic 1,2-dicarboxylic acids are obtained as major products, with highest yields in dimethylformamide, under oxygen or air.For example, the yield of pyrene-1,2-dicarboxylic acid is 82percent from 9,10-dihydrobenzopyren-7(8H)-one and 88percent from benzopyrene-7,8-dione.Minor side products include aromatic tetrones and 3-(2-carboxyaryl)propionic or 3-(2-carboxyaryl)propenoic acid, which provide mechanistic insights.