302912-44-3 Usage
Description
2,5-Dibromo-3-cyclohexylthiophene 97 is an organic compound characterized by its unique molecular structure, which features a thiophene ring with two bromine atoms at the 2nd and 5th positions, and a cyclohexyl group attached to the 3rd position. 2 5-DIBROMO-3-CYCLOHEXYLTHIOPHENE 97 is known for its potential applications in various industries due to its chemical properties.
Uses
Used in Polymer Synthesis:
2,5-Dibromo-3-cyclohexylthiophene 97 is used as a reagent in the synthesis of new donor/acceptor thiophene copolymers. Its unique structure allows for the creation of novel materials with enhanced properties, such as improved electrical conductivity or photovoltaic performance, which can be utilized in various applications, including organic solar cells and electronic devices.
Used in Chemical Research:
In the field of chemical research, 2,5-dibromo-3-cyclohexylthiophene 97 serves as a valuable compound for studying the properties and behavior of thiophene-based materials. Its synthesis and characterization can provide insights into the development of new materials and applications in various industries.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, 2,5-dibromo-3-cyclohexylthiophene 97 may also have potential applications in the pharmaceutical industry. Its unique chemical structure could be exploited for the development of new drugs or drug delivery systems, particularly in the areas of cancer treatment or other therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 302912-44-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,2,9,1 and 2 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 302912-44:
(8*3)+(7*0)+(6*2)+(5*9)+(4*1)+(3*2)+(2*4)+(1*4)=103
103 % 10 = 3
So 302912-44-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H12Br2S/c11-9-6-8(10(12)13-9)7-4-2-1-3-5-7/h6-7H,1-5H2
