303149-97-5 Usage
Uses
Used in Pharmaceutical Industry:
1-(6-CHLOROPYRIDAZIN-3-YL)PIPERIDINE-4-CARBOXAMIDE is used as a potential drug candidate for various applications due to its unique chemical structure and potential biological activity. The presence of the chloropyridazin group suggests that it could be developed to target specific receptors or pathways, making it a promising candidate for the treatment of certain diseases or conditions.
Used in Drug Development Research:
In the field of drug development, 1-(6-CHLOROPYRIDAZIN-3-YL)PIPERIDINE-4-CARBOXAMIDE is used as a starting point for the synthesis of new compounds with potential therapeutic effects. Its unique structure allows researchers to explore its interactions with biological targets, which could lead to the discovery of new drugs with improved efficacy and safety profiles.
Used in Medicinal Chemistry:
1-(6-CHLOROPYRIDAZIN-3-YL)PIPERIDINE-4-CARBOXAMIDE is utilized in medicinal chemistry as a building block for the design and synthesis of novel compounds with potential pharmaceutical applications. Its structural features can be modified to create a variety of derivatives with different biological activities, providing a valuable resource for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 303149-97-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,3,1,4 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 303149-97:
(8*3)+(7*0)+(6*3)+(5*1)+(4*4)+(3*9)+(2*9)+(1*7)=115
115 % 10 = 5
So 303149-97-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H13ClN4O/c11-8-1-2-9(14-13-8)15-5-3-7(4-6-15)10(12)16/h1-2,7H,3-6H2,(H2,12,16)
