303149-97-5 Usage
General Description
The chemical compound 1-(6-chloropyridazin-3-yl)piperidine-4-carboxamide is a piperidine derivative containing a chloropyridazin moiety. It is a carboxamide compound with potential biological activity, and it may have various pharmaceutical applications. The presence of the chloropyridazin group suggests that it could have potential use as a drug targeting specific biological pathways or receptors. However, further research is needed to fully understand its biological properties and potential uses in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 303149-97-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,3,1,4 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 303149-97:
(8*3)+(7*0)+(6*3)+(5*1)+(4*4)+(3*9)+(2*9)+(1*7)=115
115 % 10 = 5
So 303149-97-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H13ClN4O/c11-8-1-2-9(14-13-8)15-5-3-7(4-6-15)10(12)16/h1-2,7H,3-6H2,(H2,12,16)
