30332-35-5 Usage
Uses
Used in Pharmaceutical Industry:
2,3,5,6-Tetrachloro-4-iodopyridine is used as a key intermediate for the synthesis of pharmaceuticals. Its unique structure and reactivity allow for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
2,3,5,6-TETRACHLORO-4-IODOPYRIDINE is also used as an intermediate in the production of agrochemicals, specifically crop protection products. Its properties contribute to the effectiveness of these products in protecting crops from pests and diseases.
Used in Chemical Production:
2,3,5,6-Tetrachloro-4-iodopyridine serves as a building block in the synthesis of various other chemicals. Its versatility in chemical reactions makes it a valuable component in the creation of a wide range of chemical products.
However, it is important to note that due to potential health and environmental risks, 2,3,5,6-tetrachloro-4-iodopyridine should be handled with caution to ensure safety and minimize any adverse effects.
Check Digit Verification of cas no
The CAS Registry Mumber 30332-35-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,3,3 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 30332-35:
(7*3)+(6*0)+(5*3)+(4*3)+(3*2)+(2*3)+(1*5)=65
65 % 10 = 5
So 30332-35-5 is a valid CAS Registry Number.
InChI:InChI=1/C5Cl4IN/c6-1-3(10)2(7)5(9)11-4(1)8
