30389-86-7 Usage
Chemical structure
1,3-xylyl-di-(2-chloroethyl)amine is a chemical compound with two 2-chloroethylamine groups attached to a 1,3-xylyl backbone.
Classification
It is a type of nitrogen mustard, which is a class of chemical warfare agents.
Toxicity
Highly toxic and can cause severe skin, eye, and respiratory irritation, as well as systemic toxicity when absorbed into the body.
Effects
Can cause blistering, burns, and even death if not properly handled.
Vesicant properties
Classified as vesicants, meaning they can lead to blistering of the skin and mucous membranes.
Regulation
Heavily regulated and controlled under international law due to its toxicity and potential for use as a chemical weapon.
Check Digit Verification of cas no
The CAS Registry Mumber 30389-86-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,3,8 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 30389-86:
(7*3)+(6*0)+(5*3)+(4*8)+(3*9)+(2*8)+(1*6)=117
117 % 10 = 7
So 30389-86-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H17Cl2N/c1-11-3-2-4-12(9-11)10-15(7-5-13)8-6-14/h2-4,9H,5-8,10H2,1H3
