303982-14-1 Usage
Description
1-Ethyl-7-amino-1,2,3,4-tetrahydroquinoline, a bicyclic heterocyclic amine with the molecular formula C13H16N2, is a chemical compound that holds significant potential in the pharmaceutical industry. Its unique structure and properties make it a valuable component in the synthesis of various organic compounds and new drug formulations.
Uses
Used in Pharmaceutical Industry:
1-Ethyl-7-amino-1,2,3,4-tetrahydroquinoline is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of novel drugs and treatments. Its unique chemical properties allow it to be a building block in the creation of new medicinal compounds.
Used in Organic Synthesis:
In the field of organic synthesis, 1-Ethyl-7-amino-1,2,3,4-tetrahydroquinoline is utilized as a versatile intermediate for the production of a range of organic compounds. Its reactivity and structural features make it suitable for further chemical modifications and the formation of complex molecules.
Used in Drug Discovery Research:
1-Ethyl-7-amino-1,2,3,4-tetrahydroquinoline is of interest to chemists and researchers in drug discovery due to its potential to be integrated into new therapeutic agents. Its properties are under investigation for possible applications in treating various diseases and conditions, contributing to the advancement of medical science.
Check Digit Verification of cas no
The CAS Registry Mumber 303982-14-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,3,9,8 and 2 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 303982-14:
(8*3)+(7*0)+(6*3)+(5*9)+(4*8)+(3*2)+(2*1)+(1*4)=131
131 % 10 = 1
So 303982-14-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2/c1-2-13-7-3-4-9-5-6-10(12)8-11(9)13/h5-6,8H,2-4,7,12H2,1H3
