30436-87-4 Usage
Uses
Used in Organic Synthesis:
2,4-DINITROSO-1,3-NAPHTHALENEDIOL is used as a reagent in organic synthesis for various chemical reactions, contributing to the formation of new compounds and facilitating the synthesis of complex organic molecules.
Used in Analytical Chemistry:
In the field of analytical chemistry, 2,4-DINITROSO-1,3-NAPHTHALENEDIOL is utilized for its potential as a pH indicator, helping to measure and monitor the acidity or alkalinity of solutions.
Used in Research:
2,4-DINITROSO-1,3-NAPHTHALENEDIOL is also used in research settings to study its potential toxic effects, mutagenicity, and carcinogenic properties. This research aims to understand its exact mechanism of action and potential health risks, contributing to the development of safer and more effective applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 30436-87-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,4,3 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 30436-87:
(7*3)+(6*0)+(5*4)+(4*3)+(3*6)+(2*8)+(1*7)=94
94 % 10 = 4
So 30436-87-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H6N2O4/c13-9-6-4-2-1-3-5(6)7(11-15)10(14)8(9)12-16/h1-4,13-14H
