304675-72-7 Usage
Uses
Used in Organic Synthesis:
4-Nitroguaiacol potassium salt hydrate is used as a reagent in organic synthesis for various chemical reactions. Its unique chemical structure allows it to participate in a range of reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
As a pharmaceutical intermediate, 4-nitroguaiacol potassium salt hydrate plays a crucial role in the development of new drugs. Its chemical properties enable it to be used as a building block or a modifying agent in the synthesis of pharmaceutical compounds, contributing to the creation of novel therapeutic agents.
Used in Antimicrobial Applications:
4-Nitroguaiacol potassium salt hydrate has been studied for its potential antimicrobial properties. It can be used as an antimicrobial agent in various applications, such as in the development of new antibiotics or as a preservative in pharmaceutical formulations, to combat bacterial infections.
Used in Antifungal Applications:
In addition to its antimicrobial properties, 4-nitroguaiacol potassium salt hydrate has also been investigated for its potential antifungal activity. It can be utilized in the development of antifungal agents to treat fungal infections or as a preservative in various products to prevent fungal growth.
Check Digit Verification of cas no
The CAS Registry Mumber 304675-72-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,4,6,7 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 304675-72:
(8*3)+(7*0)+(6*4)+(5*6)+(4*7)+(3*5)+(2*7)+(1*2)=137
137 % 10 = 7
So 304675-72-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO4.K.H2O/c1-12-7-4-5(8(10)11)2-3-6(7)9;;/h2-4,9H,1H3;;1H2/q;+1;/p-1
