304869-93-0 Usage
Uses
Used in Pharmaceutical Industry:
8-METHYL[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE is used as a pharmaceutical compound for its potential therapeutic properties. Its unique structure may contribute to the development of new drugs, targeting specific biological pathways or receptors.
Used in Materials Science:
In the field of materials science, 8-METHYL[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE is utilized for its potential to create novel materials with specific properties. Its incorporation into material compositions could lead to advancements in areas such as electronics, sensors, or other high-tech applications.
Used in Organic Synthesis:
8-METHYL[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE serves as a key intermediate in organic synthesis, enabling the creation of more complex molecules with diverse applications. Its unique structure can be a building block for synthesizing other heterocyclic compounds with potential uses in various industries.
Further research and investigation into the properties and potential uses of 8-METHYL[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE are essential to fully explore and understand its significance and capabilities in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 304869-93-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,4,8,6 and 9 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 304869-93:
(8*3)+(7*0)+(6*4)+(5*8)+(4*6)+(3*9)+(2*9)+(1*3)=160
160 % 10 = 0
So 304869-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N4O/c1-5-4-6-7(11-10-5)2-3-8-9(6)13-14-12-8/h2-4H,1H3
