305337-12-6 Usage
General Description
4-ETHYL-5-M-TOLYL-4H-[1,2,4]TRIAZOLE-3-THIOL is a chemical compound with the molecular formula C11H13N3S. It is a heterocyclic compound containing a triazole ring and a thiol group. 4-ETHYL-5-M-TOLYL-4H-[1,2,4]TRIAZOLE-3-THIOL has potential applications in pharmaceuticals, agrochemicals, and materials science due to its diverse reactivity and biological activity. The ethyl and m-tolyl substituents on the triazole ring can affect the compound's properties and reactivity, making it valuable for various chemical and biological studies. Additionally, the presence of the thiol group adds to the compound's potential uses in organic synthesis and as a building block for more complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 305337-12-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,5,3,3 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 305337-12:
(8*3)+(7*0)+(6*5)+(5*3)+(4*3)+(3*7)+(2*1)+(1*2)=106
106 % 10 = 6
So 305337-12-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3S/c1-3-14-10(12-13-11(14)15)9-6-4-5-8(2)7-9/h4-7H,3H2,1-2H3,(H,13,15)
