30563-73-6 Usage
Chemical composition
The compound is composed of carbon (C), hydrogen (H), oxygen (O), and nitrogen (N) atoms.
Molecular structure
It features a unique structure with multiple benzene rings and a tetraazacycloicosine core.
Type of compound
It is a heterocyclic compound, which means it contains a ring of atoms with at least one heteroatom (atoms other than carbon) in the ring.
Potential applications
The compound has potential applications in the field of chemistry and pharmaceuticals, although its exact uses and effects are still being studied and understood.
Research and development
Due to its complex structure and composition, the compound may exhibit specific and unique properties that could be of interest for further research and development.
Number of atoms
The compound has a large number of atoms, which contributes to its complexity.
Hydrogen bonding
The presence of hydrogen atoms in the compound may allow for hydrogen bonding, which can influence its physical and chemical properties.
Aromaticity
The multiple benzene rings in the compound contribute to its aromaticity, which can affect its stability and reactivity.
Chirality
The compound may exhibit chirality, which means it could have different stereoisomers with distinct properties.
Solubility
The compound's solubility in various solvents may be influenced by its molecular structure and polarity.
Stability
The stability of the compound under different conditions (e.g., temperature, pressure, pH) may be an important factor to consider for its potential applications.
Reactivity
The compound's reactivity with other chemicals or biological molecules could be relevant for its potential uses in pharmaceuticals or other applications.
Biological activity
The compound may have specific biological activities, such as interacting with proteins, enzymes, or receptors, which could be explored for therapeutic applications.
Synthesis
The synthesis of the compound may involve complex chemical reactions and techniques, which could be a subject of interest for researchers in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 30563-73-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,5,6 and 3 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 30563-73:
(7*3)+(6*0)+(5*5)+(4*6)+(3*3)+(2*7)+(1*3)=96
96 % 10 = 6
So 30563-73-6 is a valid CAS Registry Number.
InChI:InChI=1/C30H28N4O2/c1-3-11-25-23(9-1)21-33-27-13-5-7-15-29(27)35-19-20-36-30-16-8-6-14-28(30)34-22-24-10-2-4-12-26(24)32-18-17-31-25/h1-16,21-22,33-34H,17-20H2/b23-21-,24-22-,31-25+,32-26+