305795-89-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-4-fluoro-5-bromoaniline is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and reactivity make it a valuable building block in the development of new drugs with specific therapeutic properties.
Used in Dye Industry:
In the dye industry, 2-Chloro-4-fluoro-5-bromoaniline is employed as a precursor in the production of dyes with specific color characteristics. Its halogenated nature contributes to the color intensity and stability of the resulting dyes.
Used in Agrochemical Industry:
2-Chloro-4-fluoro-5-bromoaniline is utilized as an intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its chemical properties allow for the development of effective and targeted agrochemicals for crop protection.
Used in Polymer Industry:
In the polymer industry, 2-Chloro-4-fluoro-5-bromoaniline is used in the production of polymers with specific properties, such as enhanced thermal stability, mechanical strength, or chemical resistance. Its incorporation into polymer structures can lead to the development of advanced materials for various applications.
Used in Organic Compounds Synthesis:
2-Chloro-4-fluoro-5-bromoaniline serves as a versatile intermediate in the synthesis of various organic compounds. Its reactivity and functional groups enable the formation of a wide range of organic molecules with diverse applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 305795-89-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,5,7,9 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 305795-89:
(8*3)+(7*0)+(6*5)+(5*7)+(4*9)+(3*5)+(2*8)+(1*9)=165
165 % 10 = 5
So 305795-89-5 is a valid CAS Registry Number.
InChI:InChI=1S/C6H4BrClFN/c7-3-1-6(10)4(8)2-5(3)9/h1-2H,10H2
