3059-71-0 Usage
Uses
Used in Pharmaceutical Industry:
4(1H)-Pyrimidinone, 2,5-dimethyl(9CI) serves as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 4(1H)-Pyrimidinone, 2,5-dimethyl(9CI) is utilized as an intermediate in the production of agrochemicals. Its incorporation into these compounds can enhance their effectiveness in agricultural applications, such as pest control and crop protection.
Used in Organic Synthesis:
4(1H)-Pyrimidinone, 2,5-dimethyl(9CI) is employed as a building block in organic synthesis, allowing chemists to create a wide range of organic compounds with diverse properties and applications.
Used in Material Science:
4(1H)-Pyrimidinone, 2,5-dimethyl(9CI) has potential applications in material science, where it can be used to develop new functional materials with unique properties. Its incorporation into these materials can lead to advancements in various fields, such as electronics, energy storage, and nanotechnology.
Used in Biological Research:
Due to its potential biological activities, 4(1H)-Pyrimidinone, 2,5-dimethyl(9CI) can be used in biological research to study its interactions with biological systems and explore its potential as a therapeutic agent or a tool for understanding biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 3059-71-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,5 and 9 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 3059-71:
(6*3)+(5*0)+(4*5)+(3*9)+(2*7)+(1*1)=80
80 % 10 = 0
So 3059-71-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c1-4-3-7-5(2)8-6(4)9/h3H,1-2H3,(H,7,8,9)
