3061-94-7 Usage
Uses
Used in Biochemistry and Pharmaceutical Research:
H-D-ALA-D-PHE-OH is utilized as a research compound for investigating peptide synthesis and structure-activity relationships. Its unique structure allows scientists to explore the interactions between amino acids and their potential effects on biological systems.
Used in Drug Development:
H-D-ALA-D-PHE-OH may have potential applications in drug development. Peptides like this dipeptide can exhibit biological activity, making them valuable as lead compounds for designing new pharmaceutical agents that could target specific biological pathways or diseases.
Used in Analytical Chemistry Techniques:
H-D-ALA-D-PHE-OH can be employed as a standard or reference material in various analytical chemistry techniques. Its consistent and well-defined structure makes it suitable for use in methods such as mass spectrometry and chromatography, where accurate measurements and comparisons are essential for reliable results.
Check Digit Verification of cas no
The CAS Registry Mumber 3061-94-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,6 and 1 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3061-94:
(6*3)+(5*0)+(4*6)+(3*1)+(2*9)+(1*4)=67
67 % 10 = 7
So 3061-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m1/s1
