306281-11-8 Usage
Uses
Used in Organic Synthesis:
2,3-Dihydro-1H-8-thia-5,7-diaza-cyclopenta[a]indene-4-thiol is used as a key intermediate in organic synthesis for its ability to participate in specific chemical reactions due to its heterocyclic nature and the presence of sulfur and nitrogen atoms.
Used in Pharmaceutical or Medicinal Applications:
In the Pharmaceutical Industry, 2,3-Dihydro-1H-8-thia-5,7-diaza-cyclopenta[a]indene-4-thiol is used as a potential active pharmaceutical ingredient or a precursor in the development of new drugs, leveraging its unique molecular structure to target specific biological pathways or mechanisms.
Used in Chemical Research:
In the field of Chemical Research, 2,3-Dihydro-1H-8-thia-5,7-diaza-cyclopenta[a]indene-4-thiol serves as a subject of study to explore its properties, reactivity, and potential interactions with other compounds, which could lead to the discovery of new chemical processes or materials.
Check Digit Verification of cas no
The CAS Registry Mumber 306281-11-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,2,8 and 1 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 306281-11:
(8*3)+(7*0)+(6*6)+(5*2)+(4*8)+(3*1)+(2*1)+(1*1)=108
108 % 10 = 8
So 306281-11-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2S2/c12-8-7-5-2-1-3-6(5)13-9(7)11-4-10-8/h4H,1-3H2,(H,10,11,12)
