3066-84-0 Usage
Uses
Used in Genetic Research:
8-Bromoguanine is used as a mutagen for inducing genetic mutations, which is crucial in studying the effects of mutations on various biological processes and understanding the mechanisms of DNA repair and genetic stability.
Used in Molecular Biology:
8-Bromoguanine is used as a photosensitizer in molecular biology applications, where its ability to absorb light and transfer energy to other molecules can be harnessed for various experimental purposes, such as DNA damage studies and the development of novel therapeutic strategies.
Used in Cancer Research:
8-Bromoguanine is used as a potential therapeutic agent in cancer research, given its mutagenic properties. It may be explored for its ability to induce mutations in cancer cells, potentially leading to cell death or a reduction in tumor growth. However, its use in this context requires careful consideration of the associated risks, such as toxicity and carcinogenicity.
Used in Drug Development:
8-Bromoguanine is used as a starting material or intermediate in the synthesis of other compounds with potential therapeutic applications. Its unique chemical properties may be exploited to develop new drugs with improved efficacy and safety profiles.
Used in Photodynamic Therapy:
8-Bromoguanine is used as a photosensitizer in photodynamic therapy, a medical treatment that involves the use of light to activate a drug that has been applied to or injected into the body. This can be particularly useful in the treatment of certain types of cancer, where the drug is selectively taken up by cancer cells, and the light activation leads to the destruction of these cells.
Used in Environmental Research:
8-Bromoguanine may be used as a tracer or indicator in environmental research, where its ability to absorb light and interact with other molecules can help in understanding the behavior of pollutants or the impact of environmental factors on ecosystems.
Used in Analytical Chemistry:
8-Bromoguanine is used as a reagent or analytical tool in various chemical analyses, where its unique properties can be employed to detect or quantify specific compounds or to study chemical reactions and mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 3066-84-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,6 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3066-84:
(6*3)+(5*0)+(4*6)+(3*6)+(2*8)+(1*4)=80
80 % 10 = 0
So 3066-84-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BrN5O/c6-4-8-1-2(9-4)10-5(7)11-3(1)12/h1H,(H3,7,8,9,10,11,12)
3066-84-0Relevant academic research and scientific papers
Hydrolysis of 2'-Deoxypurine Nucleosides. The Effect of Substitution at the C-8 Position.
Laayoun, Ali,Decout, Jean-Luc,Lhomme, Jean
, p. 4989 - 4990 (2007/10/02)
The hydrolytic stability of 2'-deoxypurine nucleosides is decreased by introduction of electronwithdrawing substituents at the C-8 position in the series of compounds 2-8, 10-14.The sulfone group causes a 2.9 x 104 rate acceleration for glycosidic, bond cleavage in compound 14.
