306934-75-8 Usage
Uses
Used in Organic Synthesis:
4-[(2-CHLORO-6-FLUOROBENZYL)OXY]-3-METHOXYBENZALDEHYDE is used as a building block in organic synthesis for the preparation of various complex organic compounds. Its unique structure and functional groups make it a valuable intermediate in the synthesis of a wide range of compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-[(2-CHLORO-6-FLUOROBENZYL)OXY]-3-METHOXYBENZALDEHYDE is used as a key intermediate for the development of pharmaceuticals and bioactive molecules. Its presence in the molecular structure can potentially impart medicinal properties to the synthesized compounds, making it an essential component in drug discovery and design processes.
Used in Pharmaceutical Industry:
4-[(2-CHLORO-6-FLUOROBENZYL)OXY]-3-METHOXYBENZALDEHYDE is used as a precursor in the pharmaceutical industry for the synthesis of drugs with potential therapeutic applications. Its unique structural features and functional groups allow for the creation of diverse molecules that can target specific biological pathways or receptors, contributing to the development of novel treatments for various diseases.
Used in Bioactive Molecule Development:
4-[(2-CHLORO-6-FLUOROBENZYL)OXY]-3-METHOXYBENZALDEHYDE is utilized in the development of bioactive molecules, which are compounds that can interact with biological systems to produce a desired effect. Its role in this process is crucial, as its structural elements can be tailored to enhance the bioactivity of the resulting molecules, making it a key component in the advancement of biomedicine.
Check Digit Verification of cas no
The CAS Registry Mumber 306934-75-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 4 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 306934-75:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*4)+(2*7)+(1*5)=148
148 % 10 = 8
So 306934-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H12ClFO3/c1-19-15-7-10(8-18)5-6-14(15)20-9-11-12(16)3-2-4-13(11)17/h2-8H,9H2,1H3
