306934-92-9 Usage
Uses
Used in Pharmaceutical Industry:
[5-(2-Pyridinyl)-2-thienyl]methylamine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a promising candidate for the development of new drugs, particularly in the areas of medicinal chemistry and drug discovery.
Used in Agrochemical Industry:
In the agrochemical sector, [5-(2-Pyridinyl)-2-thienyl]methylamine is utilized as a building block for the creation of novel agrochemicals. Its properties may contribute to the development of effective pesticides, herbicides, or other agricultural chemicals that can enhance crop protection and yield.
Used in Materials Science:
[5-(2-Pyridinyl)-2-thienyl]methylamine is employed in materials science for the development of new materials with specific properties. Its structure can be manipulated to create materials with tailored characteristics for use in various applications, such as sensors, electronic devices, or advanced materials for specific industries.
Check Digit Verification of cas no
The CAS Registry Mumber 306934-92-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 306934-92:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*4)+(2*9)+(1*2)=149
149 % 10 = 9
So 306934-92-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2S/c11-7-8-4-5-10(13-8)9-3-1-2-6-12-9/h1-6H,7,11H2
