306934-96-3 Usage
Uses
Used in Pharmaceutical Synthesis:
5-(2-Thienyl)Nicotinic Acid is used as a key intermediate in the synthesis of various pharmaceuticals and organic compounds. Its unique structure allows it to be a valuable building block for the development of new drugs and molecules with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, 5-(2-Thienyl)Nicotinic Acid is used as a reagent or a starting material for the synthesis of complex organic molecules. Its presence in the structure of various compounds makes it a subject of interest for researchers studying the properties and reactivity of different chemical entities.
Used in Material Science:
5-(2-Thienyl)Nicotinic Acid may also find applications in material science, where it could be used to develop new materials with specific properties. Its incorporation into the structure of certain compounds could lead to the creation of materials with unique characteristics, such as improved conductivity or enhanced stability.
Note: Due to the lack of information on the toxicity, safety measures, and handling of 5-(2-Thienyl)Nicotinic Acid, it is essential to exercise caution and follow proper safety procedures during its usage. This ensures the safety of individuals working with the compound and minimizes potential risks associated with its handling.
Check Digit Verification of cas no
The CAS Registry Mumber 306934-96-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 4 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 306934-96:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*4)+(2*9)+(1*6)=153
153 % 10 = 3
So 306934-96-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO2S/c12-10(13)8-4-7(5-11-6-8)9-2-1-3-14-9/h1-6H,(H,12,13)
