306935-24-0 Usage
Uses
Used in Medicinal Chemistry:
2,1,3-Benzoxadiazole-5-carbothioamide is used as a chemical intermediate for the development of new pharmaceutical compounds. Its unique structure and properties make it a promising candidate for the design and synthesis of drugs with potential therapeutic applications.
Used in Organic Synthesis:
2,1,3-Benzoxadiazole-5-carbothioamide is used as a building block in the synthesis of various organic compounds. Its presence in these compounds can impart specific properties, such as improved stability, reactivity, or biological activity, making it valuable in the development of new materials and pharmaceuticals.
Used in Research and Development:
2,1,3-Benzoxadiazole-5-carbothioamide is utilized in research and development for the exploration of its potential biological and pharmacological activities. Its unique structure allows scientists to study its interactions with biological targets and evaluate its efficacy in various applications, such as drug discovery and development.
Used in Industrial Applications:
Although not explicitly mentioned in the provided materials, 2,1,3-Benzoxadiazole-5-carbothioamide may also find use in industrial applications, such as the development of new materials with specific properties or the synthesis of intermediates for the production of other chemicals. Its versatility and potential applications make it a valuable compound for exploration in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 306935-24-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 306935-24:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*5)+(2*2)+(1*4)=140
140 % 10 = 0
So 306935-24-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3OS/c8-7(12)4-1-2-5-6(3-4)10-11-9-5/h1-3H,(H2,8,12)
