306935-48-8 Usage
Uses
Used in Medicinal Chemistry:
4-(ALLYL)-5-(QUINOL-6-YL)-1,2,4-TRIAZOLE-3-THIOL is used as a building block for the development of new pharmaceutical compounds due to its structural diversity and potential for chemical modifications. The allyl group allows for further functionalization, while the quinol-6-yl group may contribute to the compound's pharmacological properties.
Used in Drug Design:
4-(ALLYL)-5-(QUINOL-6-YL)-1,2,4-TRIAZOLE-3-THIOL is used as a potential drug candidate for the treatment of various diseases. Its unique structure and functional groups may provide opportunities for optimization and the development of novel therapeutic agents with improved efficacy and selectivity.
Used in Chemical Research:
4-(ALLYL)-5-(QUINOL-6-YL)-1,2,4-TRIAZOLE-3-THIOL is used as a chemical tool in research to explore its potential as a probe or inhibitor of specific biological targets. The presence of the triazole ring and thiol group in its structure may enable the compound to interact with various proteins or enzymes, providing insights into their mechanisms of action and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 306935-48-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 5 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 306935-48:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*5)+(2*4)+(1*8)=148
148 % 10 = 8
So 306935-48-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N4S/c1-2-8-18-13(16-17-14(18)19)11-5-6-12-10(9-11)4-3-7-15-12/h2-7,9H,1,8H2,(H,17,19)
