306935-90-0 Usage
Description
2-[4-(4-Nitrophenyl)-1,3-thiazol-2-yl]acetamide is a chemical compound with the molecular formula C11H9N3O3S. It belongs to the class of thiazole compounds and is derived from acetamide. 2-[4-(4-NITROPHENYL)-1,3-THIAZOL-2-YL]ACETAMIDE features a thiazole ring, a nitrophenyl group, and an acetamide group. Thiazole compounds are known for their potential biological activities, such as antimicrobial, antifungal, and anticancer properties. The presence of the nitrophenyl group suggests its potential use as a dye or pigment, while the acetamide group indicates its potential as an organic building block in chemical synthesis. Further research is required to fully explore the properties and potential applications of this compound in various fields.
Uses
Used in Pharmaceutical Industry:
2-[4-(4-Nitrophenyl)-1,3-thiazol-2-yl]acetamide is used as a pharmaceutical candidate for its potential antimicrobial, antifungal, and anticancer properties. The thiazole ring in the compound contributes to its biological activities, making it a promising agent for the development of new drugs to combat various diseases.
Used in Dye and Pigment Industry:
2-[4-(4-Nitrophenyl)-1,3-thiazol-2-yl]acetamide is used as a dye or pigment due to the presence of the nitrophenyl group. 2-[4-(4-NITROPHENYL)-1,3-THIAZOL-2-YL]ACETAMIDE can be utilized in the production of various colorants for different applications, such as textiles, plastics, and printing inks.
Used in Chemical Synthesis:
2-[4-(4-Nitrophenyl)-1,3-thiazol-2-yl]acetamide is used as an organic building block in chemical synthesis. The acetamide group in the compound can be employed in the synthesis of various organic compounds, potentially leading to the development of new materials and products.
Check Digit Verification of cas no
The CAS Registry Mumber 306935-90-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 5 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 306935-90:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*5)+(2*9)+(1*0)=150
150 % 10 = 0
So 306935-90-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H9N3O3S/c12-10(15)5-11-13-9(6-18-11)7-1-3-8(4-2-7)14(16)17/h1-4,6H,5H2,(H2,12,15)
