306936-14-1 Usage
Description
2,5-DIMETHYL-1-(2-THIENYLMETHYL)-1H-PYRROLE-3-CARBOXYLIC ACID is an organic compound with a unique chemical structure that features a pyrrole ring and a thiophene group. It is known for its potential applications in the pharmaceutical and chemical industries due to its versatile reactivity and functional groups.
Uses
Used in Pharmaceutical Industry:
2,5-DIMETHYL-1-(2-THIENYLMETHYL)-1H-PYRROLE-3-CARBOXYLIC ACID is used as a reagent for the preparation of substituted hydroxamic acids. These hydroxamic acids serve as inhibitors of HDAC6, a histone deacetylase enzyme that plays a role in various cellular processes, including gene regulation and cell signaling. Inhibiting HDAC6 has been explored as a therapeutic strategy for treating various diseases, such as cancer and neurodegenerative disorders.
In the context of cancer treatment, HDAC6 inhibition can lead to the accumulation of acetylated proteins, which may disrupt the stability of protein complexes involved in cell survival and proliferation. This can result in the suppression of tumor growth and the promotion of cell death in cancer cells.
Additionally, HDAC6 inhibition has been investigated for its potential to alleviate protein aggregation and improve cellular function in neurodegenerative diseases, such as Alzheimer's and Parkinson's disease. By modulating the acetylation state of proteins, HDAC6 inhibitors may help restore the normal function of proteins and reduce the toxic effects of protein aggregates.
Check Digit Verification of cas no
The CAS Registry Mumber 306936-14-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 6 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 306936-14:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*6)+(2*1)+(1*4)=141
141 % 10 = 1
So 306936-14-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO2S/c1-8-6-11(12(14)15)9(2)13(8)7-10-4-3-5-16-10/h3-6H,7H2,1-2H3,(H,14,15)