306936-15-2 Usage
Uses
Used in Pharmaceutical Research:
2,5-DIMETHYL-1-(PYRIDIN-4-YLMETHYL)-1H-PYRROLE-3-CARBOXYLIC ACID is used as a research compound for exploring its potential biological activities and therapeutic effects. Its unique chemical structure allows for further investigation into its interactions with biological targets and its potential as a lead compound in drug development.
Used in Drug Development:
In the pharmaceutical industry, 2,5-DIMETHYL-1-(PYRIDIN-4-YLMETHYL)-1H-PYRROLE-3-CARBOXYLIC ACID is used as a starting material or a building block for the synthesis of novel drug candidates. Its specific properties and potential uses would need to be further researched and evaluated to determine its suitability for specific therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 306936-15-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 306936-15:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*6)+(2*1)+(1*5)=142
142 % 10 = 2
So 306936-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O2/c1-9-7-12(13(16)17)10(2)15(9)8-11-3-5-14-6-4-11/h3-7H,8H2,1-2H3,(H,16,17)
